C21H27FN2O5S — CID 25121816
1-[(3aR,5S,6R,6aR)-5-[(3R)-1,4-dioxaspiro[4.4]nonan-3-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]-3-(4-fluorophenyl)thiourea (PubChem CID 25121816) has the molecular formula C21H27FN2O5S and a molecular weight of 438.52 g/mol. Its IUPAC name is 1-[(3aR,5S,6R,6aR)-5-[(3R)-1,4-dioxaspiro[4.4]nonan-3-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]-3-(4-fluorophenyl)thiourea.
| Compound Name | 1-[(3aR,5S,6R,6aR)-5-[(3R)-1,4-dioxaspiro[4.4]nonan-3-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]-3-(4-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 25121816 |
| Molecular Formula | C21H27FN2O5S |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | 1-[(3aR,5S,6R,6aR)-5-[(3R)-1,4-dioxaspiro[4.4]nonan-3-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]-3-(4-fluorophenyl)thiourea |
| SMILES | CC1(C)O[C@H]2O[C@H]([C@H]3COC4(CCCC4)O3)[C@@H](NC(=S)Nc3ccc(F)cc3)[C@H]2O1 |
| InChI | InChI=1S/C21H27FN2O5S/c1-20(2)28-17-15(24-19(30)23-13-7-5-12(22)6-8-13)16(26-18(17)29-20)14-11-25-21(27-14)9-3-4-10-21/h5-8,14-18H,3-4,9-11H2,1-2H3,(H2,23,24,30)/t14-,15-,16-,17-,18-/m1/s1 |
| InChIKey | OPDMSJSWLKNKFA-DUQPFJRNSA-N |
| XLogP | 3.04 |
| TPSA | 70.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|