C19H23FO7S — CID 11122539
[(3aR,5R,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy-(4-fluorophenoxy)methanethione (PubChem CID 11122539) has the molecular formula C19H23FO7S and a molecular weight of 414.45 g/mol. Its IUPAC name is [(3aR,5R,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy-(4-fluorophenoxy)methanethione.
| Compound Name | [(3aR,5R,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy-(4-fluorophenoxy)methanethione |
|---|---|
| PubChem CID | 11122539 |
| Molecular Formula | C19H23FO7S |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | [(3aR,5R,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy-(4-fluorophenoxy)methanethione |
| SMILES | CC1(C)O[C@H]2O[C@H]([C@H]3COC(C)(C)O3)[C@H](OC(=S)Oc3ccc(F)cc3)[C@H]2O1 |
| InChI | InChI=1S/C19H23FO7S/c1-18(2)21-9-12(25-18)13-14(15-16(23-13)27-19(3,4)26-15)24-17(28)22-11-7-5-10(20)6-8-11/h5-8,12-16H,9H2,1-4H3/t12-,13-,14+,15-,16-/m1/s1 |
| InChIKey | FKOCZXXTRFFPPK-IBEHDNSVSA-N |
| XLogP | 2.90 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|