C20H26O7S — CID 568075
[5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy-(4-methylphenoxy)methanethione (PubChem CID 568075) has the molecular formula C20H26O7S and a molecular weight of 410.49 g/mol. Its IUPAC name is [5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy-(4-methylphenoxy)methanethione.
| Compound Name | [5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy-(4-methylphenoxy)methanethione |
|---|---|
| PubChem CID | 568075 |
| Molecular Formula | C20H26O7S |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | [5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy-(4-methylphenoxy)methanethione |
| SMILES | Cc1ccc(OC(=S)OC2C(C3COC(C)(C)O3)OC3OC(C)(C)OC32)cc1 |
| InChI | InChI=1S/C20H26O7S/c1-11-6-8-12(9-7-11)22-18(28)24-15-14(13-10-21-19(2,3)25-13)23-17-16(15)26-20(4,5)27-17/h6-9,13-17H,10H2,1-5H3 |
| InChIKey | PFNJAEQAVXLCMV-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|