C13H21NO7 — CID 101174255
[(3aR,5R,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] carbamate (PubChem CID 101174255) has the molecular formula C13H21NO7 and a molecular weight of 303.31 g/mol. Its IUPAC name is [(3aR,5R,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] carbamate.
| Compound Name | [(3aR,5R,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] carbamate |
|---|---|
| PubChem CID | 101174255 |
| Molecular Formula | C13H21NO7 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | [(3aR,5R,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] carbamate |
| SMILES | CC1(C)O[C@H]2O[C@H]([C@H]3COC(C)(C)O3)[C@H](OC(N)=O)[C@H]2O1 |
| InChI | InChI=1S/C13H21NO7/c1-12(2)16-5-6(19-12)7-8(18-11(14)15)9-10(17-7)21-13(3,4)20-9/h6-10H,5H2,1-4H3,(H2,14,15)/t6-,7-,8+,9-,10-/m1/s1 |
| InChIKey | HYWCRPAECRXKCE-HOTMZDKISA-N |
| XLogP | 0.48 |
| TPSA | 98.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |