C15H28O6Si — CID 102321182
[(3aS,5S,6R,6aS)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy-trimethylsilane (PubChem CID 102321182) has the molecular formula C15H28O6Si and a molecular weight of 332.47 g/mol. Its IUPAC name is [(3aS,5S,6R,6aS)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy-trimethylsilane.
| Compound Name | [(3aS,5S,6R,6aS)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 102321182 |
| Molecular Formula | C15H28O6Si |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | [(3aS,5S,6R,6aS)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy-trimethylsilane |
| SMILES | CC1(C)O[C@@H]2O[C@@H]([C@@H]3COC(C)(C)O3)[C@@H](O[Si](C)(C)C)[C@@H]2O1 |
| InChI | InChI=1S/C15H28O6Si/c1-14(2)16-8-9(18-14)10-11(21-22(5,6)7)12-13(17-10)20-15(3,4)19-12/h9-13H,8H2,1-7H3/t9-,10-,11+,12-,13-/m0/s1 |
| InChIKey | IESPVZGLCPEFNL-WJTVCTBASA-N |
| XLogP | 2.23 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|