C19H26O7S — CID 134935942
[(3aR,5R,6S,6aR)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] 4-methylbenzenesulfinate (PubChem CID 134935942) has the molecular formula C19H26O7S and a molecular weight of 398.48 g/mol. Its IUPAC name is [(3aR,5R,6S,6aR)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] 4-methylbenzenesulfinate.
| Compound Name | [(3aR,5R,6S,6aR)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] 4-methylbenzenesulfinate |
|---|---|
| PubChem CID | 134935942 |
| Molecular Formula | C19H26O7S |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | [(3aR,5R,6S,6aR)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] 4-methylbenzenesulfinate |
| SMILES | Cc1ccc(S(=O)O[C@@H]2[C@H]3OC(C)(C)O[C@H]3O[C@@H]2C2COC(C)(C)O2)cc1 |
| InChI | InChI=1S/C19H26O7S/c1-11-6-8-12(9-7-11)27(20)26-15-14(13-10-21-18(2,3)23-13)22-17-16(15)24-19(4,5)25-17/h6-9,13-17H,10H2,1-5H3/t13?,14-,15+,16-,17-,27?/m1/s1 |
| InChIKey | CLRQDDZQYHKNOB-XIEQUCAQSA-N |
| XLogP | 2.43 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |