C12H16N2O7 — CID 7231161
(2S,3S,4S,5S)-2-[(1R)-1,2-dihydroxyethyl]-5-(3-nitroanilino)oxolane-3,4-diol (PubChem CID 7231161) has the molecular formula C12H16N2O7 and a molecular weight of 300.27 g/mol. Its IUPAC name is (2S,3S,4S,5S)-2-[(1R)-1,2-dihydroxyethyl]-5-(3-nitroanilino)oxolane-3,4-diol.
| Compound Name | (2S,3S,4S,5S)-2-[(1R)-1,2-dihydroxyethyl]-5-(3-nitroanilino)oxolane-3,4-diol |
|---|---|
| PubChem CID | 7231161 |
| Molecular Formula | C12H16N2O7 |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | (2S,3S,4S,5S)-2-[(1R)-1,2-dihydroxyethyl]-5-(3-nitroanilino)oxolane-3,4-diol |
| SMILES | O=[N+]([O-])c1cccc(N[C@H]2O[C@@H]([C@H](O)CO)[C@@H](O)[C@@H]2O)c1 |
| InChI | InChI=1S/C12H16N2O7/c15-5-8(16)11-9(17)10(18)12(21-11)13-6-2-1-3-7(4-6)14(19)20/h1-4,8-13,15-18H,5H2/t8-,9+,10+,11+,12+/m1/s1 |
| InChIKey | MECQYKQSBXLWMT-DGORSVRFSA-N |
| XLogP | -1.19 |
| TPSA | 145.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|