C10H15F3O5 — CID 177496696
(4S,6R)-6-methoxy-2,2-dimethyl-4-(2,2,2-trifluoroethoxy)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole (PubChem CID 177496696) has the molecular formula C10H15F3O5 and a molecular weight of 272.22 g/mol. Its IUPAC name is (4S,6R)-6-methoxy-2,2-dimethyl-4-(2,2,2-trifluoroethoxy)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole.
| Compound Name | (4S,6R)-6-methoxy-2,2-dimethyl-4-(2,2,2-trifluoroethoxy)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole |
|---|---|
| PubChem CID | 177496696 |
| Molecular Formula | C10H15F3O5 |
| Molecular Weight | 272.22 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | (4S,6R)-6-methoxy-2,2-dimethyl-4-(2,2,2-trifluoroethoxy)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole |
| SMILES | CO[C@@H]1O[C@H](OCC(F)(F)F)C2OC(C)(C)OC21 |
| InChI | InChI=1S/C10H15F3O5/c1-9(2)17-5-6(18-9)8(16-7(5)14-3)15-4-10(11,12)13/h5-8H,4H2,1-3H3/t5?,6?,7-,8+/m1/s1 |
| InChIKey | VCGLCPPXACUGMY-CRYROECRSA-N |
| XLogP | 1.41 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.22 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |