C17H39NO5Si3 — CID 22217474
N-[(2R,3R,4R,5R,6R)-6-methyl-2,4,5-tris(trimethylsilyloxy)oxan-3-yl]acetamide (PubChem CID 22217474) has the molecular formula C17H39NO5Si3 and a molecular weight of 421.76 g/mol. Its IUPAC name is N-[(2R,3R,4R,5R,6R)-6-methyl-2,4,5-tris(trimethylsilyloxy)oxan-3-yl]acetamide.
| Compound Name | N-[(2R,3R,4R,5R,6R)-6-methyl-2,4,5-tris(trimethylsilyloxy)oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 22217474 |
| Molecular Formula | C17H39NO5Si3 |
| Molecular Weight | 421.76 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | N-[(2R,3R,4R,5R,6R)-6-methyl-2,4,5-tris(trimethylsilyloxy)oxan-3-yl]acetamide |
| SMILES | CC(=O)N[C@H]1[C@@H](O[Si](C)(C)C)O[C@H](C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C17H39NO5Si3/c1-12-15(21-24(3,4)5)16(22-25(6,7)8)14(18-13(2)19)17(20-12)23-26(9,10)11/h12,14-17H,1-11H3,(H,18,19)/t12-,14-,15-,16-,17-/m1/s1 |
| InChIKey | NFZKBAZVQGFIMV-LMHBHQSJSA-N |
| XLogP | 3.53 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.76 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|