C35H81NO11Si7 — CID 91726453
N-[(3S,4R,5R,6R)-2-[1-oxo-3,4,5,6-tetrakis(trimethylsilyloxy)hexan-2-yl]oxy-4,5-bis(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-3-yl]acetamide (PubChem CID 91726453) has the molecular formula C35H81NO11Si7 and a molecular weight of 888.63 g/mol. Its IUPAC name is N-[(3S,4R,5R,6R)-2-[1-oxo-3,4,5,6-tetrakis(trimethylsilyloxy)hexan-2-yl]oxy-4,5-bis(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-3-yl]acetamide.
| Compound Name | N-[(3S,4R,5R,6R)-2-[1-oxo-3,4,5,6-tetrakis(trimethylsilyloxy)hexan-2-yl]oxy-4,5-bis(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 91726453 |
| Molecular Formula | C35H81NO11Si7 |
| Molecular Weight | 888.63 g/mol |
| Exact Mass | 887.42 |
| IUPAC Name | N-[(3S,4R,5R,6R)-2-[1-oxo-3,4,5,6-tetrakis(trimethylsilyloxy)hexan-2-yl]oxy-4,5-bis(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-3-yl]acetamide |
| SMILES | CC(=O)N[C@@H]1C(OC(C=O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(CO[Si](C)(C)C)O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C35H81NO11Si7/c1-26(38)36-30-34(47-54(20,21)22)32(45-52(14,15)16)28(24-39-48(2,3)4)42-35(30)41-27(23-37)31(44-51(11,12)13)33(46-53(17,18)19)29(43-50(8,9)10)25-40-49(5,6)7/h23,27-35H,24-25H2,1-22H3,(H,36,38)/t27?,28-,29?,30+,31?,32-,33?,34-,35?/m1/s1 |
| InChIKey | WHWFWMDHJSLUBS-BKMRFELUSA-N |
| XLogP | 7.60 |
| TPSA | 129.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 888.63 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|