C37H89NO11Si8 — CID 91754085
N-methoxy-1,3,5,6-tetrakis(trimethylsilyloxy)-4-[3,4,5-tris(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-2-yl]oxyhexan-2-imine (PubChem CID 91754085) has the molecular formula C37H89NO11Si8 and a molecular weight of 948.80 g/mol. Its IUPAC name is N-methoxy-1,3,5,6-tetrakis(trimethylsilyloxy)-4-[3,4,5-tris(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-2-yl]oxyhexan-2-imine.
| Compound Name | N-methoxy-1,3,5,6-tetrakis(trimethylsilyloxy)-4-[3,4,5-tris(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-2-yl]oxyhexan-2-imine |
|---|---|
| PubChem CID | 91754085 |
| Molecular Formula | C37H89NO11Si8 |
| Molecular Weight | 948.80 g/mol |
| Exact Mass | 947.46 |
| IUPAC Name | N-methoxy-1,3,5,6-tetrakis(trimethylsilyloxy)-4-[3,4,5-tris(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-2-yl]oxyhexan-2-imine |
| SMILES | CON=C(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C)C(CO[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C37H89NO11Si8/c1-39-38-29(26-40-50(2,3)4)32(46-54(14,15)16)33(31(45-53(11,12)13)28-42-52(8,9)10)44-37-36(49-57(23,24)25)35(48-56(20,21)22)34(47-55(17,18)19)30(43-37)27-41-51(5,6)7/h30-37H,26-28H2,1-25H3 |
| InChIKey | JALQSBKJXHFAJP-UHFFFAOYSA-N |
| XLogP | 9.75 |
| TPSA | 113.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 948.80 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|