C20H24O2 — CID 154019435
2,3,5,6-tetramethyl-2,3-diphenyl-1,4-dioxane (PubChem CID 154019435) has the molecular formula C20H24O2 and a molecular weight of 296.41 g/mol. Its IUPAC name is 2,3,5,6-tetramethyl-2,3-diphenyl-1,4-dioxane.
| Compound Name | 2,3,5,6-tetramethyl-2,3-diphenyl-1,4-dioxane |
|---|---|
| PubChem CID | 154019435 |
| Molecular Formula | C20H24O2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | 2,3,5,6-tetramethyl-2,3-diphenyl-1,4-dioxane |
| SMILES | CC1OC(C)(c2ccccc2)C(C)(c2ccccc2)OC1C |
| InChI | InChI=1S/C20H24O2/c1-15-16(2)22-20(4,18-13-9-6-10-14-18)19(3,21-15)17-11-7-5-8-12-17/h5-16H,1-4H3 |
| InChIKey | WUFIXOMELBVZKH-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |