C17H18 — CID 100931572
[(2S,3R)-2,3-dimethyl-1-phenylcyclopropyl]benzene (PubChem CID 100931572) has the molecular formula C17H18 and a molecular weight of 222.33 g/mol. Its IUPAC name is [(2S,3R)-2,3-dimethyl-1-phenylcyclopropyl]benzene.
| Compound Name | [(2S,3R)-2,3-dimethyl-1-phenylcyclopropyl]benzene |
|---|---|
| PubChem CID | 100931572 |
| Molecular Formula | C17H18 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | [(2S,3R)-2,3-dimethyl-1-phenylcyclopropyl]benzene |
| SMILES | C[C@@H]1[C@H](C)C1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H18/c1-13-14(2)17(13,15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-14H,1-2H3/t13-,14+ |
| InChIKey | MKHSXAGITGYKDT-OKILXGFUSA-N |
| XLogP | 4.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |