C36H32 — CID 177493569
(1R,4S,5R,8S)-9,10,11,12-tetraphenyltetracyclo[6.4.0.04,12.05,9]dodec-10-ene (PubChem CID 177493569) has the molecular formula C36H32 and a molecular weight of 464.65 g/mol. Its IUPAC name is (1R,4S,5R,8S)-9,10,11,12-tetraphenyltetracyclo[6.4.0.04,12.05,9]dodec-10-ene.
| Compound Name | (1R,4S,5R,8S)-9,10,11,12-tetraphenyltetracyclo[6.4.0.04,12.05,9]dodec-10-ene |
|---|---|
| PubChem CID | 177493569 |
| Molecular Formula | C36H32 |
| Molecular Weight | 464.65 g/mol |
| Exact Mass | 464.25 |
| IUPAC Name | (1R,4S,5R,8S)-9,10,11,12-tetraphenyltetracyclo[6.4.0.04,12.05,9]dodec-10-ene |
| SMILES | c1ccc(C2=C(c3ccccc3)C3(c4ccccc4)[C@@H]4CC[C@H]3[C@H]3CC[C@@H]4C23c2ccccc2)cc1 |
| InChI | InChI=1S/C36H32/c1-5-13-25(14-6-1)33-34(26-15-7-2-8-16-26)36(28-19-11-4-12-20-28)31-23-24-32(36)30-22-21-29(31)35(30,33)27-17-9-3-10-18-27/h1-20,29-32H,21-24H2/t29-,30+,31+,32-,35?,36? |
| InChIKey | FIDAJQPTLZOJEM-GSQDJVKWSA-N |
| XLogP | 8.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.65 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|