C42H32 — CID 101078426
[(1S,3R)-2,3-diphenyl-2-(1,2,3-triphenylcycloprop-2-en-1-yl)cyclopropyl]benzene (PubChem CID 101078426) has the molecular formula C42H32 and a molecular weight of 536.72 g/mol. Its IUPAC name is [(1S,3R)-2,3-diphenyl-2-(1,2,3-triphenylcycloprop-2-en-1-yl)cyclopropyl]benzene.
| Compound Name | [(1S,3R)-2,3-diphenyl-2-(1,2,3-triphenylcycloprop-2-en-1-yl)cyclopropyl]benzene |
|---|---|
| PubChem CID | 101078426 |
| Molecular Formula | C42H32 |
| Molecular Weight | 536.72 g/mol |
| Exact Mass | 536.25 |
| IUPAC Name | [(1S,3R)-2,3-diphenyl-2-(1,2,3-triphenylcycloprop-2-en-1-yl)cyclopropyl]benzene |
| SMILES | c1ccc(C2=C(c3ccccc3)C2(c2ccccc2)C2(c3ccccc3)[C@H](c3ccccc3)[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C42H32/c1-7-19-31(20-8-1)37-38(32-21-9-2-10-22-32)41(37,35-27-15-5-16-28-35)42(36-29-17-6-18-30-36)39(33-23-11-3-12-24-33)40(42)34-25-13-4-14-26-34/h1-30,37-38H/t37-,38+,41? |
| InChIKey | WHNGAMPVROMPEU-IVNORFTDSA-N |
| XLogP | 10.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.72 |
| LogP ≤ 5 | 10.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|