C21H20O — CID 98163294
(1S,2S,4S,5S,7R)-3,3-dimethyl-2,4-diphenyltricyclo[3.2.0.02,7]heptan-6-one (PubChem CID 98163294) has the molecular formula C21H20O and a molecular weight of 288.39 g/mol. Its IUPAC name is (1S,2S,4S,5S,7R)-3,3-dimethyl-2,4-diphenyltricyclo[3.2.0.02,7]heptan-6-one.
| Compound Name | (1S,2S,4S,5S,7R)-3,3-dimethyl-2,4-diphenyltricyclo[3.2.0.02,7]heptan-6-one |
|---|---|
| PubChem CID | 98163294 |
| Molecular Formula | C21H20O |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | (1S,2S,4S,5S,7R)-3,3-dimethyl-2,4-diphenyltricyclo[3.2.0.02,7]heptan-6-one |
| SMILES | CC1(C)[C@H](c2ccccc2)[C@H]2C(=O)[C@@H]3[C@H]2[C@]31c1ccccc1 |
| InChI | InChI=1S/C21H20O/c1-20(2)16(13-9-5-3-6-10-13)15-17-18(19(15)22)21(17,20)14-11-7-4-8-12-14/h3-12,15-18H,1-2H3/t15-,16-,17+,18+,21-/m1/s1 |
| InChIKey | BZNIPFYGQVUZJW-YXZMJPADSA-N |
| XLogP | 4.19 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |