C20H22O2 — CID 102142694
(2S,3S,4S)-2-hydroxy-2,5,5-trimethyl-3,4-diphenylcyclopentan-1-one (PubChem CID 102142694) has the molecular formula C20H22O2 and a molecular weight of 294.39 g/mol. Its IUPAC name is (2S,3S,4S)-2-hydroxy-2,5,5-trimethyl-3,4-diphenylcyclopentan-1-one.
| Compound Name | (2S,3S,4S)-2-hydroxy-2,5,5-trimethyl-3,4-diphenylcyclopentan-1-one |
|---|---|
| PubChem CID | 102142694 |
| Molecular Formula | C20H22O2 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | (2S,3S,4S)-2-hydroxy-2,5,5-trimethyl-3,4-diphenylcyclopentan-1-one |
| SMILES | CC1(C)C(=O)[C@@](C)(O)[C@H](c2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C20H22O2/c1-19(2)16(14-10-6-4-7-11-14)17(20(3,22)18(19)21)15-12-8-5-9-13-15/h4-13,16-17,22H,1-3H3/t16-,17-,20+/m1/s1 |
| InChIKey | DBBOGTFGGKGKOH-HLIPFELVSA-N |
| XLogP | 3.91 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |