C14H14N2O2 — CID 7347371
(3S,4R)-5,5-dimethyl-2,6-dioxo-4-phenylpiperidine-3-carbonitrile (PubChem CID 7347371) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is (3S,4R)-5,5-dimethyl-2,6-dioxo-4-phenylpiperidine-3-carbonitrile.
| Compound Name | (3S,4R)-5,5-dimethyl-2,6-dioxo-4-phenylpiperidine-3-carbonitrile |
|---|---|
| PubChem CID | 7347371 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | (3S,4R)-5,5-dimethyl-2,6-dioxo-4-phenylpiperidine-3-carbonitrile |
| SMILES | CC1(C)C(=O)NC(=O)[C@H](C#N)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C14H14N2O2/c1-14(2)11(9-6-4-3-5-7-9)10(8-15)12(17)16-13(14)18/h3-7,10-11H,1-2H3,(H,16,17,18)/t10-,11+/m1/s1 |
| InChIKey | AXFSGAGJHJHOBM-MNOVXSKESA-N |
| XLogP | 1.59 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|