C20H20N2O — CID 138970589
(3R,4R,6S)-5,5-dimethyl-2-oxo-4,6-diphenylpiperidine-3-carbonitrile (PubChem CID 138970589) has the molecular formula C20H20N2O and a molecular weight of 304.39 g/mol. Its IUPAC name is (3R,4R,6S)-5,5-dimethyl-2-oxo-4,6-diphenylpiperidine-3-carbonitrile.
| Compound Name | (3R,4R,6S)-5,5-dimethyl-2-oxo-4,6-diphenylpiperidine-3-carbonitrile |
|---|---|
| PubChem CID | 138970589 |
| Molecular Formula | C20H20N2O |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | (3R,4R,6S)-5,5-dimethyl-2-oxo-4,6-diphenylpiperidine-3-carbonitrile |
| SMILES | CC1(C)[C@@H](c2ccccc2)NC(=O)[C@@H](C#N)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C20H20N2O/c1-20(2)17(14-9-5-3-6-10-14)16(13-21)19(23)22-18(20)15-11-7-4-8-12-15/h3-12,16-18H,1-2H3,(H,22,23)/t16-,17-,18+/m0/s1 |
| InChIKey | MADATIFDXRDCRD-OKZBNKHCSA-N |
| XLogP | 3.81 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |