C13H17NO — CID 138970238
(6S)-5,5-dimethyl-6-phenylpiperidin-2-one (PubChem CID 138970238) has the molecular formula C13H17NO and a molecular weight of 203.29 g/mol. Its IUPAC name is (6S)-5,5-dimethyl-6-phenylpiperidin-2-one.
| Compound Name | (6S)-5,5-dimethyl-6-phenylpiperidin-2-one |
|---|---|
| PubChem CID | 138970238 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | (6S)-5,5-dimethyl-6-phenylpiperidin-2-one |
| SMILES | CC1(C)CCC(=O)N[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C13H17NO/c1-13(2)9-8-11(15)14-12(13)10-6-4-3-5-7-10/h3-7,12H,8-9H2,1-2H3,(H,14,15)/t12-/m1/s1 |
| InChIKey | XJHRZRYWCDMLNL-GFCCVEGCSA-N |
| XLogP | 2.66 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |