C18H19NO2 — CID 103466411
4-(methoxymethyl)-4,5-diphenylpyrrolidin-2-one (PubChem CID 103466411) has the molecular formula C18H19NO2 and a molecular weight of 281.36 g/mol. Its IUPAC name is 4-(methoxymethyl)-4,5-diphenylpyrrolidin-2-one.
| Compound Name | 4-(methoxymethyl)-4,5-diphenylpyrrolidin-2-one |
|---|---|
| PubChem CID | 103466411 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 4-(methoxymethyl)-4,5-diphenylpyrrolidin-2-one |
| SMILES | COCC1(c2ccccc2)CC(=O)NC1c1ccccc1 |
| InChI | InChI=1S/C18H19NO2/c1-21-13-18(15-10-6-3-7-11-15)12-16(20)19-17(18)14-8-4-2-5-9-14/h2-11,17H,12-13H2,1H3,(H,19,20) |
| InChIKey | POFBKMGPALWTBF-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |