C14H11N3O2 — CID 51537056
(3R,5S)-4-methyl-2,6-dioxo-4-phenylpiperidine-3,5-dicarbonitrile (PubChem CID 51537056) has the molecular formula C14H11N3O2 and a molecular weight of 253.26 g/mol. Its IUPAC name is (3R,5S)-4-methyl-2,6-dioxo-4-phenylpiperidine-3,5-dicarbonitrile.
| Compound Name | (3R,5S)-4-methyl-2,6-dioxo-4-phenylpiperidine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 51537056 |
| Molecular Formula | C14H11N3O2 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | (3R,5S)-4-methyl-2,6-dioxo-4-phenylpiperidine-3,5-dicarbonitrile |
| SMILES | CC1(c2ccccc2)[C@H](C#N)C(=O)NC(=O)[C@@H]1C#N |
| InChI | InChI=1S/C14H11N3O2/c1-14(9-5-3-2-4-6-9)10(7-15)12(18)17-13(19)11(14)8-16/h2-6,10-11H,1H3,(H,17,18,19)/t10-,11+,14? |
| InChIKey | DUHIKGWFSCWEBA-BVUQATHDSA-N |
| XLogP | 0.88 |
| TPSA | 93.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|