C12H13NO2 — CID 921939
(3S,4S)-3,4-dimethyl-3-phenylpyrrolidine-2,5-dione (PubChem CID 921939) has the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. Its IUPAC name is (3S,4S)-3,4-dimethyl-3-phenylpyrrolidine-2,5-dione.
| Compound Name | (3S,4S)-3,4-dimethyl-3-phenylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 921939 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | (3S,4S)-3,4-dimethyl-3-phenylpyrrolidine-2,5-dione |
| SMILES | C[C@@H]1C(=O)NC(=O)[C@]1(C)c1ccccc1 |
| InChI | InChI=1S/C12H13NO2/c1-8-10(14)13-11(15)12(8,2)9-6-4-3-5-7-9/h3-8H,1-2H3,(H,13,14,15)/t8-,12+/m1/s1 |
| InChIKey | BPAQZGAZYDCWAN-PELKAZGASA-N |
| XLogP | 1.24 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|