C11H12Br2 — CID 14471431
(2,2-dibromo-1,3-dimethylcyclopropyl)benzene (PubChem CID 14471431) has the molecular formula C11H12Br2 and a molecular weight of 304.02 g/mol. Its IUPAC name is (2,2-dibromo-1,3-dimethylcyclopropyl)benzene.
| Compound Name | (2,2-dibromo-1,3-dimethylcyclopropyl)benzene |
|---|---|
| PubChem CID | 14471431 |
| Molecular Formula | C11H12Br2 |
| Molecular Weight | 304.02 g/mol |
| Exact Mass | 301.93 |
| IUPAC Name | (2,2-dibromo-1,3-dimethylcyclopropyl)benzene |
| SMILES | CC1C(Br)(Br)C1(C)c1ccccc1 |
| InChI | InChI=1S/C11H12Br2/c1-8-10(2,11(8,12)13)9-6-4-3-5-7-9/h3-8H,1-2H3 |
| InChIKey | CWJHTSHCNLUIMZ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.02 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|