C15H18O4 — CID 134966090
trans-dimethyl (2R,3S)-2,3-dimethyl-2-phenylcyclopropane-1,1-dicarboxylate (PubChem CID 134966090) has the molecular formula C15H18O4 and a molecular weight of 262.31 g/mol. Its IUPAC name is trans-dimethyl (2R,3S)-2,3-dimethyl-2-phenylcyclopropane-1,1-dicarboxylate.
| Compound Name | trans-dimethyl (2R,3S)-2,3-dimethyl-2-phenylcyclopropane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 134966090 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | trans-dimethyl (2R,3S)-2,3-dimethyl-2-phenylcyclopropane-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)[C@@H](C)[C@]1(C)c1ccccc1 |
| InChI | InChI=1S/C15H18O4/c1-10-14(2,11-8-6-5-7-9-11)15(10,12(16)18-3)13(17)19-4/h5-10H,1-4H3/t10-,14+/m0/s1 |
| InChIKey | ZKSZIYOCNSPPAZ-IINYFYTJSA-N |
| XLogP | 1.93 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|