C33H28O4 — CID 12722356
dimethyl 3-(2,2-diphenylethenyl)-2,2-diphenylcyclopropane-1,1-dicarboxylate (PubChem CID 12722356) has the molecular formula C33H28O4 and a molecular weight of 488.58 g/mol. Its IUPAC name is dimethyl 3-(2,2-diphenylethenyl)-2,2-diphenylcyclopropane-1,1-dicarboxylate.
| Compound Name | dimethyl 3-(2,2-diphenylethenyl)-2,2-diphenylcyclopropane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 12722356 |
| Molecular Formula | C33H28O4 |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | dimethyl 3-(2,2-diphenylethenyl)-2,2-diphenylcyclopropane-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C(C=C(c2ccccc2)c2ccccc2)C1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H28O4/c1-36-30(34)33(31(35)37-2)29(23-28(24-15-7-3-8-16-24)25-17-9-4-10-18-25)32(33,26-19-11-5-12-20-26)27-21-13-6-14-22-27/h3-23,29H,1-2H3 |
| InChIKey | GRWSJEYHSGYKQA-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|