C17H14O4 — CID 132961943
methyl (2R,3S)-3-benzoyl-2-phenyloxirane-2-carboxylate (PubChem CID 132961943) has the molecular formula C17H14O4 and a molecular weight of 282.30 g/mol. Its IUPAC name is methyl (2R,3S)-3-benzoyl-2-phenyloxirane-2-carboxylate.
| Compound Name | methyl (2R,3S)-3-benzoyl-2-phenyloxirane-2-carboxylate |
|---|---|
| PubChem CID | 132961943 |
| Molecular Formula | C17H14O4 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | methyl (2R,3S)-3-benzoyl-2-phenyloxirane-2-carboxylate |
| SMILES | COC(=O)[C@]1(c2ccccc2)O[C@@H]1C(=O)c1ccccc1 |
| InChI | InChI=1S/C17H14O4/c1-20-16(19)17(13-10-6-3-7-11-13)15(21-17)14(18)12-8-4-2-5-9-12/h2-11,15H,1H3/t15-,17-/m1/s1 |
| InChIKey | UTUHLKFTVXLCNK-NVXWUHKLSA-N |
| XLogP | 2.34 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|