C17H13F3O2 — CID 135069666
[(2R,3S)-3-methyl-3-phenyloxiran-2-yl]-[4-(trifluoromethyl)phenyl]methanone (PubChem CID 135069666) has the molecular formula C17H13F3O2 and a molecular weight of 306.28 g/mol. Its IUPAC name is [(2R,3S)-3-methyl-3-phenyloxiran-2-yl]-[4-(trifluoromethyl)phenyl]methanone.
| Compound Name | [(2R,3S)-3-methyl-3-phenyloxiran-2-yl]-[4-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 135069666 |
| Molecular Formula | C17H13F3O2 |
| Molecular Weight | 306.28 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | [(2R,3S)-3-methyl-3-phenyloxiran-2-yl]-[4-(trifluoromethyl)phenyl]methanone |
| SMILES | C[C@@]1(c2ccccc2)O[C@H]1C(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H13F3O2/c1-16(12-5-3-2-4-6-12)15(22-16)14(21)11-7-9-13(10-8-11)17(18,19)20/h2-10,15H,1H3/t15-,16-/m0/s1 |
| InChIKey | DRXIFYASVUHSCH-HOTGVXAUSA-N |
| XLogP | 4.20 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.28 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|