C31H20F6O3 — CID 57209775
bis[3-phenyl-3-[3-(trifluoromethyl)phenyl]oxiran-2-yl]methanone (PubChem CID 57209775) has the molecular formula C31H20F6O3 and a molecular weight of 554.49 g/mol. Its IUPAC name is bis[3-phenyl-3-[3-(trifluoromethyl)phenyl]oxiran-2-yl]methanone.
| Compound Name | bis[3-phenyl-3-[3-(trifluoromethyl)phenyl]oxiran-2-yl]methanone |
|---|---|
| PubChem CID | 57209775 |
| Molecular Formula | C31H20F6O3 |
| Molecular Weight | 554.49 g/mol |
| Exact Mass | 554.13 |
| IUPAC Name | bis[3-phenyl-3-[3-(trifluoromethyl)phenyl]oxiran-2-yl]methanone |
| SMILES | O=C(C1OC1(c1ccccc1)c1cccc(C(F)(F)F)c1)C1OC1(c1ccccc1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C31H20F6O3/c32-30(33,34)23-15-7-13-21(17-23)28(19-9-3-1-4-10-19)26(39-28)25(38)27-29(40-27,20-11-5-2-6-12-20)22-14-8-16-24(18-22)31(35,36)37/h1-18,26-27H |
| InChIKey | ODIBDAOSMPEMQP-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 42.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.49 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|