C11H9F3O3 — CID 117258800
2-[3-(trifluoromethyl)phenyl]oxetane-2-carboxylic acid (PubChem CID 117258800) has the molecular formula C11H9F3O3 and a molecular weight of 246.18 g/mol. Its IUPAC name is 2-[3-(trifluoromethyl)phenyl]oxetane-2-carboxylic acid.
| Compound Name | 2-[3-(trifluoromethyl)phenyl]oxetane-2-carboxylic acid |
|---|---|
| PubChem CID | 117258800 |
| Molecular Formula | C11H9F3O3 |
| Molecular Weight | 246.18 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | 2-[3-(trifluoromethyl)phenyl]oxetane-2-carboxylic acid |
| SMILES | O=C(O)C1(c2cccc(C(F)(F)F)c2)CCO1 |
| InChI | InChI=1S/C11H9F3O3/c12-11(13,14)8-3-1-2-7(6-8)10(9(15)16)4-5-17-10/h1-3,6H,4-5H2,(H,15,16) |
| InChIKey | VGLRRWYHMGYBCA-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.18 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |