C14H14F3NO2 — CID 117194011
2-[3-(trifluoromethyl)phenyl]-7-azabicyclo[2.2.1]heptane-2-carboxylic acid (PubChem CID 117194011) has the molecular formula C14H14F3NO2 and a molecular weight of 285.26 g/mol. Its IUPAC name is 2-[3-(trifluoromethyl)phenyl]-7-azabicyclo[2.2.1]heptane-2-carboxylic acid.
| Compound Name | 2-[3-(trifluoromethyl)phenyl]-7-azabicyclo[2.2.1]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 117194011 |
| Molecular Formula | C14H14F3NO2 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 2-[3-(trifluoromethyl)phenyl]-7-azabicyclo[2.2.1]heptane-2-carboxylic acid |
| SMILES | O=C(O)C1(c2cccc(C(F)(F)F)c2)CC2CCC1N2 |
| InChI | InChI=1S/C14H14F3NO2/c15-14(16,17)9-3-1-2-8(6-9)13(12(19)20)7-10-4-5-11(13)18-10/h1-3,6,10-11,18H,4-5,7H2,(H,19,20) |
| InChIKey | JSFCDNHZHBZMSZ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |