C12H11F3O4 — CID 70195563
2-[3-(trifluoromethyl)phenyl]-1,3-dioxane-2-carboxylic acid (PubChem CID 70195563) has the molecular formula C12H11F3O4 and a molecular weight of 276.21 g/mol. Its IUPAC name is 2-[3-(trifluoromethyl)phenyl]-1,3-dioxane-2-carboxylic acid.
| Compound Name | 2-[3-(trifluoromethyl)phenyl]-1,3-dioxane-2-carboxylic acid |
|---|---|
| PubChem CID | 70195563 |
| Molecular Formula | C12H11F3O4 |
| Molecular Weight | 276.21 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | 2-[3-(trifluoromethyl)phenyl]-1,3-dioxane-2-carboxylic acid |
| SMILES | O=C(O)C1(c2cccc(C(F)(F)F)c2)OCCCO1 |
| InChI | InChI=1S/C12H11F3O4/c13-12(14,15)9-4-1-3-8(7-9)11(10(16)17)18-5-2-6-19-11/h1,3-4,7H,2,5-6H2,(H,16,17) |
| InChIKey | WOCCGZUJJVADLW-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.21 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |