C13H11F8N — CID 98042591
(2R)-2-(1,1,2,2,2-pentafluoroethyl)-2-[3-(trifluoromethyl)phenyl]pyrrolidine (PubChem CID 98042591) has the molecular formula C13H11F8N and a molecular weight of 333.22 g/mol. Its IUPAC name is (2R)-2-(1,1,2,2,2-pentafluoroethyl)-2-[3-(trifluoromethyl)phenyl]pyrrolidine.
| Compound Name | (2R)-2-(1,1,2,2,2-pentafluoroethyl)-2-[3-(trifluoromethyl)phenyl]pyrrolidine |
|---|---|
| PubChem CID | 98042591 |
| Molecular Formula | C13H11F8N |
| Molecular Weight | 333.22 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | (2R)-2-(1,1,2,2,2-pentafluoroethyl)-2-[3-(trifluoromethyl)phenyl]pyrrolidine |
| SMILES | FC(F)(F)c1cccc([C@@]2(C(F)(F)C(F)(F)F)CCCN2)c1 |
| InChI | InChI=1S/C13H11F8N/c14-11(15,16)9-4-1-3-8(7-9)10(5-2-6-22-10)12(17,18)13(19,20)21/h1,3-4,7,22H,2,5-6H2/t10-/m1/s1 |
| InChIKey | DQJCNTDMUUCOGP-SNVBAGLBSA-N |
| XLogP | 4.48 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.22 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|