C17H23F3 — CID 59590181
1-(1-tert-butylcyclohexyl)-3-(trifluoromethyl)benzene (PubChem CID 59590181) has the molecular formula C17H23F3 and a molecular weight of 284.37 g/mol. Its IUPAC name is 1-(1-tert-butylcyclohexyl)-3-(trifluoromethyl)benzene.
| Compound Name | 1-(1-tert-butylcyclohexyl)-3-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 59590181 |
| Molecular Formula | C17H23F3 |
| Molecular Weight | 284.37 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | 1-(1-tert-butylcyclohexyl)-3-(trifluoromethyl)benzene |
| SMILES | CC(C)(C)C1(c2cccc(C(F)(F)F)c2)CCCCC1 |
| InChI | InChI=1S/C17H23F3/c1-15(2,3)16(10-5-4-6-11-16)13-8-7-9-14(12-13)17(18,19)20/h7-9,12H,4-6,10-11H2,1-3H3 |
| InChIKey | QPMIBXNCTBXYIB-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.37 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |