C16H20F3N — CID 65007104
2-[3-(trifluoromethyl)phenyl]spiro[3.5]nonan-2-amine (PubChem CID 65007104) has the molecular formula C16H20F3N and a molecular weight of 283.34 g/mol. Its IUPAC name is 2-[3-(trifluoromethyl)phenyl]spiro[3.5]nonan-2-amine.
| Compound Name | 2-[3-(trifluoromethyl)phenyl]spiro[3.5]nonan-2-amine |
|---|---|
| PubChem CID | 65007104 |
| Molecular Formula | C16H20F3N |
| Molecular Weight | 283.34 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | 2-[3-(trifluoromethyl)phenyl]spiro[3.5]nonan-2-amine |
| SMILES | NC1(c2cccc(C(F)(F)F)c2)CC2(CCCCC2)C1 |
| InChI | InChI=1S/C16H20F3N/c17-16(18,19)13-6-4-5-12(9-13)15(20)10-14(11-15)7-2-1-3-8-14/h4-6,9H,1-3,7-8,10-11,20H2 |
| InChIKey | UUUZAVMBRDUBRL-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.34 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |