C24H19NO3 — CID 102035757
methyl (1R,7R,7aR)-1-benzoyl-7-phenyl-1,7a-dihydroazirino[1,2-a]indole-7-carboxylate (PubChem CID 102035757) has the molecular formula C24H19NO3 and a molecular weight of 369.42 g/mol. Its IUPAC name is methyl (1R,7R,7aR)-1-benzoyl-7-phenyl-1,7a-dihydroazirino[1,2-a]indole-7-carboxylate.
| Compound Name | methyl (1R,7R,7aR)-1-benzoyl-7-phenyl-1,7a-dihydroazirino[1,2-a]indole-7-carboxylate |
|---|---|
| PubChem CID | 102035757 |
| Molecular Formula | C24H19NO3 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | methyl (1R,7R,7aR)-1-benzoyl-7-phenyl-1,7a-dihydroazirino[1,2-a]indole-7-carboxylate |
| SMILES | COC(=O)[C@]1(c2ccccc2)c2ccccc2N2[C@H]1[C@@H]2C(=O)c1ccccc1 |
| InChI | InChI=1S/C24H19NO3/c1-28-23(27)24(17-12-6-3-7-13-17)18-14-8-9-15-19(18)25-20(22(24)25)21(26)16-10-4-2-5-11-16/h2-15,20,22H,1H3/t20-,22-,24+,25?/m0/s1 |
| InChIKey | AGXNRWXQFKFBEQ-SKMNOIAPSA-N |
| XLogP | 3.60 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|