C17H18O4 — CID 98172991
methyl (1S,2R,4R,5S,6S,7R)-7-benzoyl-6-methyl-3-oxatricyclo[3.2.1.02,4]octane-6-carboxylate (PubChem CID 98172991) has the molecular formula C17H18O4 and a molecular weight of 286.33 g/mol. Its IUPAC name is methyl (1S,2R,4R,5S,6S,7R)-7-benzoyl-6-methyl-3-oxatricyclo[3.2.1.02,4]octane-6-carboxylate.
| Compound Name | methyl (1S,2R,4R,5S,6S,7R)-7-benzoyl-6-methyl-3-oxatricyclo[3.2.1.02,4]octane-6-carboxylate |
|---|---|
| PubChem CID | 98172991 |
| Molecular Formula | C17H18O4 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | methyl (1S,2R,4R,5S,6S,7R)-7-benzoyl-6-methyl-3-oxatricyclo[3.2.1.02,4]octane-6-carboxylate |
| SMILES | COC(=O)[C@@]1(C)[C@@H]2C[C@H]([C@H]3O[C@@H]32)[C@H]1C(=O)c1ccccc1 |
| InChI | InChI=1S/C17H18O4/c1-17(16(19)20-2)11-8-10(14-15(11)21-14)12(17)13(18)9-6-4-3-5-7-9/h3-7,10-12,14-15H,8H2,1-2H3/t10-,11+,12-,14+,15+,17-/m0/s1 |
| InChIKey | MKYZMQHQZWVLQX-MGBPFJEPSA-N |
| XLogP | 2.08 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|