C22H22O4 — CID 100937971
dimethyl (1R,2S)-1,2-dimethyl-3,4-diphenylcyclobut-3-ene-1,2-dicarboxylate (PubChem CID 100937971) has the molecular formula C22H22O4 and a molecular weight of 350.41 g/mol. Its IUPAC name is dimethyl (1R,2S)-1,2-dimethyl-3,4-diphenylcyclobut-3-ene-1,2-dicarboxylate.
| Compound Name | dimethyl (1R,2S)-1,2-dimethyl-3,4-diphenylcyclobut-3-ene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 100937971 |
| Molecular Formula | C22H22O4 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | dimethyl (1R,2S)-1,2-dimethyl-3,4-diphenylcyclobut-3-ene-1,2-dicarboxylate |
| SMILES | COC(=O)[C@@]1(C)C(c2ccccc2)=C(c2ccccc2)[C@@]1(C)C(=O)OC |
| InChI | InChI=1S/C22H22O4/c1-21(19(23)25-3)17(15-11-7-5-8-12-15)18(16-13-9-6-10-14-16)22(21,2)20(24)26-4/h5-14H,1-4H3/t21-,22+ |
| InChIKey | CSNJCTQKICQVIR-SZPZYZBQSA-N |
| XLogP | 3.97 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|