C24H30O3Si — CID 102291630
methyl (1R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3-diphenylcycloprop-2-ene-1-carboxylate (PubChem CID 102291630) has the molecular formula C24H30O3Si and a molecular weight of 394.59 g/mol. Its IUPAC name is methyl (1R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3-diphenylcycloprop-2-ene-1-carboxylate.
| Compound Name | methyl (1R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3-diphenylcycloprop-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 102291630 |
| Molecular Formula | C24H30O3Si |
| Molecular Weight | 394.59 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | methyl (1R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3-diphenylcycloprop-2-ene-1-carboxylate |
| SMILES | COC(=O)[C@@]1(c2ccccc2)C(CO[Si](C)(C)C(C)(C)C)=C1c1ccccc1 |
| InChI | InChI=1S/C24H30O3Si/c1-23(2,3)28(5,6)27-17-20-21(18-13-9-7-10-14-18)24(20,22(25)26-4)19-15-11-8-12-16-19/h7-16H,17H2,1-6H3/t24-/m0/s1 |
| InChIKey | IIHLRWZJZHJRFT-DEOSSOPVSA-N |
| XLogP | 5.59 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.59 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|