C22H29NO4Si — CID 135068671
methyl 5-acetyl-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-phenylpyridine-2-carboxylate (PubChem CID 135068671) has the molecular formula C22H29NO4Si and a molecular weight of 399.56 g/mol. Its IUPAC name is methyl 5-acetyl-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-phenylpyridine-2-carboxylate.
| Compound Name | methyl 5-acetyl-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-phenylpyridine-2-carboxylate |
|---|---|
| PubChem CID | 135068671 |
| Molecular Formula | C22H29NO4Si |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | methyl 5-acetyl-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-phenylpyridine-2-carboxylate |
| SMILES | COC(=O)c1cc(-c2ccccc2)c(C(C)=O)c(CO[Si](C)(C)C(C)(C)C)n1 |
| InChI | InChI=1S/C22H29NO4Si/c1-15(24)20-17(16-11-9-8-10-12-16)13-18(21(25)26-5)23-19(20)14-27-28(6,7)22(2,3)4/h8-13H,14H2,1-7H3 |
| InChIKey | NXAMMNCGKZJWPB-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|