C24H23NO4 — CID 102202429
diethyl 6-benzyl-4-phenylpyridine-2,5-dicarboxylate (PubChem CID 102202429) has the molecular formula C24H23NO4 and a molecular weight of 389.45 g/mol. Its IUPAC name is diethyl 6-benzyl-4-phenylpyridine-2,5-dicarboxylate.
| Compound Name | diethyl 6-benzyl-4-phenylpyridine-2,5-dicarboxylate |
|---|---|
| PubChem CID | 102202429 |
| Molecular Formula | C24H23NO4 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | diethyl 6-benzyl-4-phenylpyridine-2,5-dicarboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccccc2)c(C(=O)OCC)c(Cc2ccccc2)n1 |
| InChI | InChI=1S/C24H23NO4/c1-3-28-23(26)21-16-19(18-13-9-6-10-14-18)22(24(27)29-4-2)20(25-21)15-17-11-7-5-8-12-17/h5-14,16H,3-4,15H2,1-2H3 |
| InChIKey | ZADNDCGNWHKELB-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |