C27H23NO2 — CID 167433740
ethyl 2-(3-methylphenyl)-4,6-diphenylpyridine-3-carboxylate (PubChem CID 167433740) has the molecular formula C27H23NO2 and a molecular weight of 393.49 g/mol. Its IUPAC name is ethyl 2-(3-methylphenyl)-4,6-diphenylpyridine-3-carboxylate.
| Compound Name | ethyl 2-(3-methylphenyl)-4,6-diphenylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 167433740 |
| Molecular Formula | C27H23NO2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | ethyl 2-(3-methylphenyl)-4,6-diphenylpyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)cc(-c2ccccc2)nc1-c1cccc(C)c1 |
| InChI | InChI=1S/C27H23NO2/c1-3-30-27(29)25-23(20-12-6-4-7-13-20)18-24(21-14-8-5-9-15-21)28-26(25)22-16-10-11-19(2)17-22/h4-18H,3H2,1-2H3 |
| InChIKey | OKTDSTMLXMLPQT-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |