C19H24N2O2 — CID 71591622
ethyl 6-(butylamino)-2-methyl-4-phenylpyridine-3-carboxylate (PubChem CID 71591622) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is ethyl 6-(butylamino)-2-methyl-4-phenylpyridine-3-carboxylate.
| Compound Name | ethyl 6-(butylamino)-2-methyl-4-phenylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 71591622 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | ethyl 6-(butylamino)-2-methyl-4-phenylpyridine-3-carboxylate |
| SMILES | CCCCNc1cc(-c2ccccc2)c(C(=O)OCC)c(C)n1 |
| InChI | InChI=1S/C19H24N2O2/c1-4-6-12-20-17-13-16(15-10-8-7-9-11-15)18(14(3)21-17)19(22)23-5-2/h7-11,13H,4-6,12H2,1-3H3,(H,20,21) |
| InChIKey | LHIXDAZOUBFNNV-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|