C26H31ClN2O4Si — CID 19815459
methyl 2-[4-[[5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-chloro-2-formylimidazol-1-yl]methyl]phenyl]benzoate (PubChem CID 19815459) has the molecular formula C26H31ClN2O4Si and a molecular weight of 499.08 g/mol. Its IUPAC name is methyl 2-[4-[[5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-chloro-2-formylimidazol-1-yl]methyl]phenyl]benzoate.
| Compound Name | methyl 2-[4-[[5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-chloro-2-formylimidazol-1-yl]methyl]phenyl]benzoate |
|---|---|
| PubChem CID | 19815459 |
| Molecular Formula | C26H31ClN2O4Si |
| Molecular Weight | 499.08 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | methyl 2-[4-[[5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-chloro-2-formylimidazol-1-yl]methyl]phenyl]benzoate |
| SMILES | COC(=O)c1ccccc1-c1ccc(Cn2c(C=O)nc(Cl)c2CO[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C26H31ClN2O4Si/c1-26(2,3)34(5,6)33-17-22-24(27)28-23(16-30)29(22)15-18-11-13-19(14-12-18)20-9-7-8-10-21(20)25(31)32-4/h7-14,16H,15,17H2,1-6H3 |
| InChIKey | IYBDMDZMYSPORJ-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.08 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|