C22H22N2O3 — CID 11035827
methyl 2-[4-[(5-formyl-2-propylimidazol-1-yl)methyl]phenyl]benzoate (PubChem CID 11035827) has the molecular formula C22H22N2O3 and a molecular weight of 362.43 g/mol. Its IUPAC name is methyl 2-[4-[(5-formyl-2-propylimidazol-1-yl)methyl]phenyl]benzoate.
| Compound Name | methyl 2-[4-[(5-formyl-2-propylimidazol-1-yl)methyl]phenyl]benzoate |
|---|---|
| PubChem CID | 11035827 |
| Molecular Formula | C22H22N2O3 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | methyl 2-[4-[(5-formyl-2-propylimidazol-1-yl)methyl]phenyl]benzoate |
| SMILES | CCCc1ncc(C=O)n1Cc1ccc(-c2ccccc2C(=O)OC)cc1 |
| InChI | InChI=1S/C22H22N2O3/c1-3-6-21-23-13-18(15-25)24(21)14-16-9-11-17(12-10-16)19-7-4-5-8-20(19)22(26)27-2/h4-5,7-13,15H,3,6,14H2,1-2H3 |
| InChIKey | BLSGRNPHGGGORU-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|