C29H40ClN3O3Si — CID 19799002
2-[4-[[2-butyl-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-chloroimidazol-1-yl]methyl]anilino]-2-phenylacetic acid (PubChem CID 19799002) has the molecular formula C29H40ClN3O3Si and a molecular weight of 542.20 g/mol. Its IUPAC name is 2-[4-[[2-butyl-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-chloroimidazol-1-yl]methyl]anilino]-2-phenylacetic acid.
| Compound Name | 2-[4-[[2-butyl-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-chloroimidazol-1-yl]methyl]anilino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 19799002 |
| Molecular Formula | C29H40ClN3O3Si |
| Molecular Weight | 542.20 g/mol |
| Exact Mass | 541.25 |
| IUPAC Name | 2-[4-[[2-butyl-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-chloroimidazol-1-yl]methyl]anilino]-2-phenylacetic acid |
| SMILES | CCCCc1nc(Cl)c(CO[Si](C)(C)C(C)(C)C)n1Cc1ccc(NC(C(=O)O)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H40ClN3O3Si/c1-7-8-14-25-32-27(30)24(20-36-37(5,6)29(2,3)4)33(25)19-21-15-17-23(18-16-21)31-26(28(34)35)22-12-10-9-11-13-22/h9-13,15-18,26,31H,7-8,14,19-20H2,1-6H3,(H,34,35) |
| InChIKey | SECDZJQMNJFPLN-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.20 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|