C20H26ClN3O3S — CID 75951837
4-[[2-butyl-4-chloro-5-[[(2-methyl-3-sulfanylpropanoyl)amino]methyl]imidazol-1-yl]methyl]benzoic acid (PubChem CID 75951837) has the molecular formula C20H26ClN3O3S and a molecular weight of 423.97 g/mol. Its IUPAC name is 4-[[2-butyl-4-chloro-5-[[(2-methyl-3-sulfanylpropanoyl)amino]methyl]imidazol-1-yl]methyl]benzoic acid.
| Compound Name | 4-[[2-butyl-4-chloro-5-[[(2-methyl-3-sulfanylpropanoyl)amino]methyl]imidazol-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 75951837 |
| Molecular Formula | C20H26ClN3O3S |
| Molecular Weight | 423.97 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | 4-[[2-butyl-4-chloro-5-[[(2-methyl-3-sulfanylpropanoyl)amino]methyl]imidazol-1-yl]methyl]benzoic acid |
| SMILES | CCCCc1nc(Cl)c(CNC(=O)C(C)CS)n1Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C20H26ClN3O3S/c1-3-4-5-17-23-18(21)16(10-22-19(25)13(2)12-28)24(17)11-14-6-8-15(9-7-14)20(26)27/h6-9,13,28H,3-5,10-12H2,1-2H3,(H,22,25)(H,26,27) |
| InChIKey | TWTOFVDNVACNCA-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.97 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|