C27H32ClN3O4S — CID 87219092
4-[[5-[[(2-benzyl-3-sulfanylpropanoyl)amino]methyl]-2-butyl-4-chloroimidazol-1-yl]methyl]-3-methoxybenzoic acid (PubChem CID 87219092) has the molecular formula C27H32ClN3O4S and a molecular weight of 530.09 g/mol. Its IUPAC name is 4-[[5-[[(2-benzyl-3-sulfanylpropanoyl)amino]methyl]-2-butyl-4-chloroimidazol-1-yl]methyl]-3-methoxybenzoic acid.
| Compound Name | 4-[[5-[[(2-benzyl-3-sulfanylpropanoyl)amino]methyl]-2-butyl-4-chloroimidazol-1-yl]methyl]-3-methoxybenzoic acid |
|---|---|
| PubChem CID | 87219092 |
| Molecular Formula | C27H32ClN3O4S |
| Molecular Weight | 530.09 g/mol |
| Exact Mass | 529.18 |
| IUPAC Name | 4-[[5-[[(2-benzyl-3-sulfanylpropanoyl)amino]methyl]-2-butyl-4-chloroimidazol-1-yl]methyl]-3-methoxybenzoic acid |
| SMILES | CCCCc1nc(Cl)c(CNC(=O)C(CS)Cc2ccccc2)n1Cc1ccc(C(=O)O)cc1OC |
| InChI | InChI=1S/C27H32ClN3O4S/c1-3-4-10-24-30-25(28)22(15-29-26(32)21(17-36)13-18-8-6-5-7-9-18)31(24)16-20-12-11-19(27(33)34)14-23(20)35-2/h5-9,11-12,14,21,36H,3-4,10,13,15-17H2,1-2H3,(H,29,32)(H,33,34) |
| InChIKey | AKNOQHXOEVFXBO-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.09 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|