C23H35N3OS — CID 141217328
N-[(3-benzyl-2-butylimidazol-4-yl)methyl]-5-methyl-2-(sulfanylmethyl)hexanamide (PubChem CID 141217328) has the molecular formula C23H35N3OS and a molecular weight of 401.62 g/mol. Its IUPAC name is N-[(3-benzyl-2-butylimidazol-4-yl)methyl]-5-methyl-2-(sulfanylmethyl)hexanamide.
| Compound Name | N-[(3-benzyl-2-butylimidazol-4-yl)methyl]-5-methyl-2-(sulfanylmethyl)hexanamide |
|---|---|
| PubChem CID | 141217328 |
| Molecular Formula | C23H35N3OS |
| Molecular Weight | 401.62 g/mol |
| Exact Mass | 401.25 |
| IUPAC Name | N-[(3-benzyl-2-butylimidazol-4-yl)methyl]-5-methyl-2-(sulfanylmethyl)hexanamide |
| SMILES | CCCCc1ncc(CNC(=O)C(CS)CCC(C)C)n1Cc1ccccc1 |
| InChI | InChI=1S/C23H35N3OS/c1-4-5-11-22-24-14-21(26(22)16-19-9-7-6-8-10-19)15-25-23(27)20(17-28)13-12-18(2)3/h6-10,14,18,20,28H,4-5,11-13,15-17H2,1-3H3,(H,25,27) |
| InChIKey | SGDFBJNZLVLPSM-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.62 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|