methyl 2-benzyl-3-(3-benzyl-2-butylimidazol-4-yl)propanoate

C25H30N2O2 — CID 22400442

IUPACmethyl 2-benzyl-3-(3-benzyl-2-butylimidazol-4-yl)propanoate
SMILESCCCCc1ncc(CC(Cc2ccccc2)C(=O)OC)n1Cc1ccccc1
InChIInChI=1S/C25H30N2O2/c1-3-4-15-24-26-18-23(27(24)19-21-13-9-6-10-14-21)17-22(25(28)29-2)16-20-11-7-5-8-12-20/h5-14,18,22H,3-4,15-17,19H2,1-2H3
InChIKeyMCIXSTJYPYHLPZ-UHFFFAOYSA-N
MW390.53 g/mol
LogP4.85
Rot. Bonds10

About methyl 2-benzyl-3-(3-benzyl-2-butylimidazol-4-yl)propanoate

methyl 2-benzyl-3-(3-benzyl-2-butylimidazol-4-yl)propanoate (PubChem CID 22400442) has the molecular formula C25H30N2O2 and a molecular weight of 390.53 g/mol. Its IUPAC name is methyl 2-benzyl-3-(3-benzyl-2-butylimidazol-4-yl)propanoate.

Molecular Properties

Compound Namemethyl 2-benzyl-3-(3-benzyl-2-butylimidazol-4-yl)propanoate
PubChem CID22400442
Molecular FormulaC25H30N2O2
Molecular Weight390.53 g/mol
Exact Mass390.23
IUPAC Namemethyl 2-benzyl-3-(3-benzyl-2-butylimidazol-4-yl)propanoate
SMILESCCCCc1ncc(CC(Cc2ccccc2)C(=O)OC)n1Cc1ccccc1
InChIInChI=1S/C25H30N2O2/c1-3-4-15-24-26-18-23(27(24)19-21-13-9-6-10-14-21)17-22(25(28)29-2)16-20-11-7-5-8-12-20/h5-14,18,22H,3-4,15-17,19H2,1-2H3
InChIKeyMCIXSTJYPYHLPZ-UHFFFAOYSA-N
XLogP4.85
TPSA44.12 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds10
Heavy Atoms29
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500390.53
LogP ≤ 54.85
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 2-benzyl-3-(3-benzyl-2-butylimidazol-4-yl)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-benzyl-3-(3-benzyl-2-butylimidazol-4-yl)propanoate?
The IUPAC name of methyl 2-benzyl-3-(3-benzyl-2-butylimidazol-4-yl)propanoate (CID 22400442) is methyl 2-benzyl-3-(3-benzyl-2-butylimidazol-4-yl)propanoate.
What is the SMILES notation for methyl 2-benzyl-3-(3-benzyl-2-butylimidazol-4-yl)propanoate?
The canonical SMILES for methyl 2-benzyl-3-(3-benzyl-2-butylimidazol-4-yl)propanoate is CCCCc1ncc(CC(Cc2ccccc2)C(=O)OC)n1Cc1ccccc1.
What is the InChIKey of methyl 2-benzyl-3-(3-benzyl-2-butylimidazol-4-yl)propanoate?
The InChIKey is MCIXSTJYPYHLPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H30N2O2/c1-3-4-15-24-26-18-23(27(24)19-21-13-9-6-10-14-21)17-22(25(28)29-2)16-20-11-7-5-8-12-20/h5-14,18,22H,3-4,15-17,19H2,1-2H3.
What are the key properties of methyl 2-benzyl-3-(3-benzyl-2-butylimidazol-4-yl)propanoate?
methyl 2-benzyl-3-(3-benzyl-2-butylimidazol-4-yl)propanoate has a molecular weight of 390.53 g/mol, XLogP of 4.85, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-benzyl-3-(3-benzyl-2-butylimidazol-4-yl)propanoate is sourced from PubChem (CID 22400442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).