C25H30N2O2 — CID 22400442
methyl 2-benzyl-3-(3-benzyl-2-butylimidazol-4-yl)propanoate (PubChem CID 22400442) has the molecular formula C25H30N2O2 and a molecular weight of 390.53 g/mol. Its IUPAC name is methyl 2-benzyl-3-(3-benzyl-2-butylimidazol-4-yl)propanoate.
| Compound Name | methyl 2-benzyl-3-(3-benzyl-2-butylimidazol-4-yl)propanoate |
|---|---|
| PubChem CID | 22400442 |
| Molecular Formula | C25H30N2O2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | methyl 2-benzyl-3-(3-benzyl-2-butylimidazol-4-yl)propanoate |
| SMILES | CCCCc1ncc(CC(Cc2ccccc2)C(=O)OC)n1Cc1ccccc1 |
| InChI | InChI=1S/C25H30N2O2/c1-3-4-15-24-26-18-23(27(24)19-21-13-9-6-10-14-21)17-22(25(28)29-2)16-20-11-7-5-8-12-20/h5-14,18,22H,3-4,15-17,19H2,1-2H3 |
| InChIKey | MCIXSTJYPYHLPZ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |